C25H35O5P — CID 21312865
[2-butyl-2-(1-methoxy-2-oxo-1,2-diphenylethyl)hexyl]phosphonic acid (PubChem CID 21312865) has the molecular formula C25H35O5P and a molecular weight of 446.52 g/mol. Its IUPAC name is [2-butyl-2-(1-methoxy-2-oxo-1,2-diphenylethyl)hexyl]phosphonic acid.
| Compound Name | [2-butyl-2-(1-methoxy-2-oxo-1,2-diphenylethyl)hexyl]phosphonic acid |
|---|---|
| PubChem CID | 21312865 |
| Molecular Formula | C25H35O5P |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | [2-butyl-2-(1-methoxy-2-oxo-1,2-diphenylethyl)hexyl]phosphonic acid |
| SMILES | CCCCC(CCCC)(CP(=O)(O)O)C(OC)(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H35O5P/c1-4-6-18-24(19-7-5-2,20-31(27,28)29)25(30-3,22-16-12-9-13-17-22)23(26)21-14-10-8-11-15-21/h8-17H,4-7,18-20H2,1-3H3,(H2,27,28,29) |
| InChIKey | CKFKPVJDGYKLSZ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|