About 6-[4-(4-chlorophenoxy)phenyl]hept-4-yne-1,6-diol
6-[4-(4-chlorophenoxy)phenyl]hept-4-yne-1,6-diol (PubChem CID 21322310) has the molecular formula C19H19ClO3
and a molecular weight of 330.81 g/mol. Its IUPAC name is 6-[4-(4-chlorophenoxy)phenyl]hept-4-yne-1,6-diol.
Molecular Properties
| Compound Name | 6-[4-(4-chlorophenoxy)phenyl]hept-4-yne-1,6-diol |
| PubChem CID | 21322310 |
| Molecular Formula | C19H19ClO3 |
| Molecular Weight | 330.81 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 6-[4-(4-chlorophenoxy)phenyl]hept-4-yne-1,6-diol |
| SMILES | CC(O)(C#CCCCO)c1ccc(Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H19ClO3/c1-19(22,13-3-2-4-14-21)15-5-9-17(10-6-15)23-18-11-7-16(20)8-12-18/h5-12,21-22H,2,4,14H2,1H3 |
| InChIKey | DLGJTUYOTKFMPS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.81 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[4-(4-chlorophenoxy)phenyl]hept-4-yne-1,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(4-chlorophenoxy)phenyl]hept-4-yne-1,6-diol?
The IUPAC name of 6-[4-(4-chlorophenoxy)phenyl]hept-4-yne-1,6-diol (CID 21322310) is 6-[4-(4-chlorophenoxy)phenyl]hept-4-yne-1,6-diol.
What is the SMILES notation for 6-[4-(4-chlorophenoxy)phenyl]hept-4-yne-1,6-diol?
The canonical SMILES for 6-[4-(4-chlorophenoxy)phenyl]hept-4-yne-1,6-diol is CC(O)(C#CCCCO)c1ccc(Oc2ccc(Cl)cc2)cc1.
What is the InChIKey of 6-[4-(4-chlorophenoxy)phenyl]hept-4-yne-1,6-diol?
The InChIKey is DLGJTUYOTKFMPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19ClO3/c1-19(22,13-3-2-4-14-21)15-5-9-17(10-6-15)23-18-11-7-16(20)8-12-18/h5-12,21-22H,2,4,14H2,1H3.
What are the key properties of 6-[4-(4-chlorophenoxy)phenyl]hept-4-yne-1,6-diol?
6-[4-(4-chlorophenoxy)phenyl]hept-4-yne-1,6-diol has a molecular weight of 330.81 g/mol, XLogP of 4.12, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(4-chlorophenoxy)phenyl]hept-4-yne-1,6-diol is sourced from PubChem (CID 21322310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).