C18H17ClO3 — CID 21322373
5-[4-(4-chlorophenoxy)phenyl]hex-3-yne-1,5-diol (PubChem CID 21322373) has the molecular formula C18H17ClO3 and a molecular weight of 316.78 g/mol. Its IUPAC name is 5-[4-(4-chlorophenoxy)phenyl]hex-3-yne-1,5-diol.
| Compound Name | 5-[4-(4-chlorophenoxy)phenyl]hex-3-yne-1,5-diol |
|---|---|
| PubChem CID | 21322373 |
| Molecular Formula | C18H17ClO3 |
| Molecular Weight | 316.78 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 5-[4-(4-chlorophenoxy)phenyl]hex-3-yne-1,5-diol |
| SMILES | CC(O)(C#CCCO)c1ccc(Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H17ClO3/c1-18(21,12-2-3-13-20)14-4-8-16(9-5-14)22-17-10-6-15(19)7-11-17/h4-11,20-21H,3,13H2,1H3 |
| InChIKey | KWOAHRVSNUOFRM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.78 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|