C19H22N2O4 — CID 2132796
2-(pyridine-3-carbonylamino)ethyl 2-(2,4,6-trimethylphenoxy)acetate (PubChem CID 2132796) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-(pyridine-3-carbonylamino)ethyl 2-(2,4,6-trimethylphenoxy)acetate.
| Compound Name | 2-(pyridine-3-carbonylamino)ethyl 2-(2,4,6-trimethylphenoxy)acetate |
|---|---|
| PubChem CID | 2132796 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-(pyridine-3-carbonylamino)ethyl 2-(2,4,6-trimethylphenoxy)acetate |
| SMILES | Cc1cc(C)c(OCC(=O)OCCNC(=O)c2cccnc2)c(C)c1 |
| InChI | InChI=1S/C19H22N2O4/c1-13-9-14(2)18(15(3)10-13)25-12-17(22)24-8-7-21-19(23)16-5-4-6-20-11-16/h4-6,9-11H,7-8,12H2,1-3H3,(H,21,23) |
| InChIKey | NQHMRJGYLASPHK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|