C10H16N4S — CID 21330764
4-ethyl-N-methyl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbothioamide (PubChem CID 21330764) has the molecular formula C10H16N4S and a molecular weight of 224.33 g/mol. Its IUPAC name is 4-ethyl-N-methyl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbothioamide.
| Compound Name | 4-ethyl-N-methyl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbothioamide |
|---|---|
| PubChem CID | 21330764 |
| Molecular Formula | C10H16N4S |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 4-ethyl-N-methyl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbothioamide |
| SMILES | CCC1c2nc[nH]c2CCN1C(=S)NC |
| InChI | InChI=1S/C10H16N4S/c1-3-8-9-7(12-6-13-9)4-5-14(8)10(15)11-2/h6,8H,3-5H2,1-2H3,(H,11,15)(H,12,13) |
| InChIKey | WSUXMDMWCSWUBD-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|