C21H25ClN4O5 — CID 21340127
(2,4,6-trimethylcyclohexyl) 2-[4-acetyl-5-(4-chloro-3-nitrophenyl)-1,2,4-triazol-3-yl]acetate (PubChem CID 21340127) has the molecular formula C21H25ClN4O5 and a molecular weight of 448.91 g/mol. Its IUPAC name is (2,4,6-trimethylcyclohexyl) 2-[4-acetyl-5-(4-chloro-3-nitrophenyl)-1,2,4-triazol-3-yl]acetate.
| Compound Name | (2,4,6-trimethylcyclohexyl) 2-[4-acetyl-5-(4-chloro-3-nitrophenyl)-1,2,4-triazol-3-yl]acetate |
|---|---|
| PubChem CID | 21340127 |
| Molecular Formula | C21H25ClN4O5 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | (2,4,6-trimethylcyclohexyl) 2-[4-acetyl-5-(4-chloro-3-nitrophenyl)-1,2,4-triazol-3-yl]acetate |
| SMILES | CC(=O)n1c(CC(=O)OC2C(C)CC(C)CC2C)nnc1-c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H25ClN4O5/c1-11-7-12(2)20(13(3)8-11)31-19(28)10-18-23-24-21(25(18)14(4)27)15-5-6-16(22)17(9-15)26(29)30/h5-6,9,11-13,20H,7-8,10H2,1-4H3 |
| InChIKey | OSIYQACJWFRKAE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 117.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|