C28H34ClN5O4 — CID 22983659
(2,6-ditert-butyl-4-methylcyclohexyl) 2-(4-chloro-3-nitrophenyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 22983659) has the molecular formula C28H34ClN5O4 and a molecular weight of 540.06 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methylcyclohexyl) 2-(4-chloro-3-nitrophenyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,6-ditert-butyl-4-methylcyclohexyl) 2-(4-chloro-3-nitrophenyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 22983659 |
| Molecular Formula | C28H34ClN5O4 |
| Molecular Weight | 540.06 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | (2,6-ditert-butyl-4-methylcyclohexyl) 2-(4-chloro-3-nitrophenyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1cn2[nH]c(-c3ccc(Cl)c([N+](=O)[O-])c3)nc2c1C(=O)OC1C(C(C)(C)C)CC(C)CC1C(C)(C)C |
| InChI | InChI=1S/C28H34ClN5O4/c1-15-11-17(27(2,3)4)23(18(12-15)28(5,6)7)38-26(35)22-20(30-8)14-33-25(22)31-24(32-33)16-9-10-19(29)21(13-16)34(36)37/h9-10,13-15,17-18,23H,11-12H2,1-7H3,(H,31,32) |
| InChIKey | FCEOTBIANQXQOI-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 106.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.06 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|