C20H32O3 — CID 21351609
oxan-2-yl 3,5-diethyltricyclo[5.2.1.02,6]decane-8-carboxylate (PubChem CID 21351609) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is oxan-2-yl 3,5-diethyltricyclo[5.2.1.02,6]decane-8-carboxylate.
| Compound Name | oxan-2-yl 3,5-diethyltricyclo[5.2.1.02,6]decane-8-carboxylate |
|---|---|
| PubChem CID | 21351609 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | oxan-2-yl 3,5-diethyltricyclo[5.2.1.02,6]decane-8-carboxylate |
| SMILES | CCC1CC(CC)C2C3CC(CC3C(=O)OC3CCCCO3)C12 |
| InChI | InChI=1S/C20H32O3/c1-3-12-9-13(4-2)19-15-10-14(18(12)19)11-16(15)20(21)23-17-7-5-6-8-22-17/h12-19H,3-11H2,1-2H3 |
| InChIKey | XRZKSKLYSCIRKT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |