C28H28N4O5S — CID 21357979
5-[4-(4-phenylmethoxyphenyl)-4,5-dihydro-1,3-oxazol-2-yl]-2-N-(3,4,5-trimethoxyphenyl)-1,3-thiazole-2,4-diamine (PubChem CID 21357979) has the molecular formula C28H28N4O5S and a molecular weight of 532.62 g/mol. Its IUPAC name is 5-[4-(4-phenylmethoxyphenyl)-4,5-dihydro-1,3-oxazol-2-yl]-2-N-(3,4,5-trimethoxyphenyl)-1,3-thiazole-2,4-diamine.
| Compound Name | 5-[4-(4-phenylmethoxyphenyl)-4,5-dihydro-1,3-oxazol-2-yl]-2-N-(3,4,5-trimethoxyphenyl)-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 21357979 |
| Molecular Formula | C28H28N4O5S |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | 5-[4-(4-phenylmethoxyphenyl)-4,5-dihydro-1,3-oxazol-2-yl]-2-N-(3,4,5-trimethoxyphenyl)-1,3-thiazole-2,4-diamine |
| SMILES | COc1cc(Nc2nc(N)c(C3=NC(c4ccc(OCc5ccccc5)cc4)CO3)s2)cc(OC)c1OC |
| InChI | InChI=1S/C28H28N4O5S/c1-33-22-13-19(14-23(34-2)24(22)35-3)30-28-32-26(29)25(38-28)27-31-21(16-37-27)18-9-11-20(12-10-18)36-15-17-7-5-4-6-8-17/h4-14,21H,15-16,29H2,1-3H3,(H,30,32) |
| InChIKey | MNPPHZLUKAXINU-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 109.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |