C20H19N5O3S — CID 24986814
5-quinoxalin-2-yl-2-N-(3,4,5-trimethoxyphenyl)-1,3-thiazole-2,4-diamine (PubChem CID 24986814) has the molecular formula C20H19N5O3S and a molecular weight of 409.47 g/mol. Its IUPAC name is 5-quinoxalin-2-yl-2-N-(3,4,5-trimethoxyphenyl)-1,3-thiazole-2,4-diamine.
| Compound Name | 5-quinoxalin-2-yl-2-N-(3,4,5-trimethoxyphenyl)-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 24986814 |
| Molecular Formula | C20H19N5O3S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 5-quinoxalin-2-yl-2-N-(3,4,5-trimethoxyphenyl)-1,3-thiazole-2,4-diamine |
| SMILES | COc1cc(Nc2nc(N)c(-c3cnc4ccccc4n3)s2)cc(OC)c1OC |
| InChI | InChI=1S/C20H19N5O3S/c1-26-15-8-11(9-16(27-2)17(15)28-3)23-20-25-19(21)18(29-20)14-10-22-12-6-4-5-7-13(12)24-14/h4-10H,21H2,1-3H3,(H,23,25) |
| InChIKey | QSXFNNTZFVBNLD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 104.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |