C25H23N7O5S2 — CID 21358492
N-[3-[5-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,2,4-oxadiazol-3-yl]phenyl]-5-methyl-1,3-thiazole-2-carboxamide (PubChem CID 21358492) has the molecular formula C25H23N7O5S2 and a molecular weight of 565.64 g/mol. Its IUPAC name is N-[3-[5-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,2,4-oxadiazol-3-yl]phenyl]-5-methyl-1,3-thiazole-2-carboxamide.
| Compound Name | N-[3-[5-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,2,4-oxadiazol-3-yl]phenyl]-5-methyl-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 21358492 |
| Molecular Formula | C25H23N7O5S2 |
| Molecular Weight | 565.64 g/mol |
| Exact Mass | 565.12 |
| IUPAC Name | N-[3-[5-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,2,4-oxadiazol-3-yl]phenyl]-5-methyl-1,3-thiazole-2-carboxamide |
| SMILES | COc1cc(Nc2nc(N)c(-c3nc(-c4cccc(NC(=O)c5ncc(C)s5)c4)no3)s2)cc(OC)c1OC |
| InChI | InChI=1S/C25H23N7O5S2/c1-12-11-27-24(38-12)22(33)28-14-7-5-6-13(8-14)21-31-23(37-32-21)19-20(26)30-25(39-19)29-15-9-16(34-2)18(36-4)17(10-15)35-3/h5-11H,26H2,1-4H3,(H,28,33)(H,29,30) |
| InChIKey | VKWFDKCNGYPTQF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 159.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.64 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |