C30H30N6O6S — CID 59093926
(2S)-N-[3-[5-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,2,4-oxadiazol-3-yl]-4-methylphenyl]-2-methoxy-2-phenylacetamide (PubChem CID 59093926) has the molecular formula C30H30N6O6S and a molecular weight of 602.67 g/mol. Its IUPAC name is (2S)-N-[3-[5-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,2,4-oxadiazol-3-yl]-4-methylphenyl]-2-methoxy-2-phenylacetamide.
| Compound Name | (2S)-N-[3-[5-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,2,4-oxadiazol-3-yl]-4-methylphenyl]-2-methoxy-2-phenylacetamide |
|---|---|
| PubChem CID | 59093926 |
| Molecular Formula | C30H30N6O6S |
| Molecular Weight | 602.67 g/mol |
| Exact Mass | 602.19 |
| IUPAC Name | (2S)-N-[3-[5-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,2,4-oxadiazol-3-yl]-4-methylphenyl]-2-methoxy-2-phenylacetamide |
| SMILES | COc1cc(Nc2nc(N)c(-c3nc(-c4cc(NC(=O)[C@@H](OC)c5ccccc5)ccc4C)no3)s2)cc(OC)c1OC |
| InChI | InChI=1S/C30H30N6O6S/c1-16-11-12-18(32-28(37)23(40-4)17-9-7-6-8-10-17)13-20(16)27-35-29(42-36-27)25-26(31)34-30(43-25)33-19-14-21(38-2)24(41-5)22(15-19)39-3/h6-15,23H,31H2,1-5H3,(H,32,37)(H,33,34)/t23-/m0/s1 |
| InChIKey | QGDSWBIOJIHGMM-QHCPKHFHSA-N |
| XLogP | 5.85 |
| TPSA | 155.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.67 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |