C29H30N6O6S — CID 21358414
N-[3-[5-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,2,4-oxadiazol-3-yl]-4-methylphenyl]-2-(cyclohexen-1-yl)-2-oxoacetamide (PubChem CID 21358414) has the molecular formula C29H30N6O6S and a molecular weight of 590.66 g/mol. Its IUPAC name is N-[3-[5-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,2,4-oxadiazol-3-yl]-4-methylphenyl]-2-(cyclohexen-1-yl)-2-oxoacetamide.
| Compound Name | N-[3-[5-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,2,4-oxadiazol-3-yl]-4-methylphenyl]-2-(cyclohexen-1-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 21358414 |
| Molecular Formula | C29H30N6O6S |
| Molecular Weight | 590.66 g/mol |
| Exact Mass | 590.19 |
| IUPAC Name | N-[3-[5-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,2,4-oxadiazol-3-yl]-4-methylphenyl]-2-(cyclohexen-1-yl)-2-oxoacetamide |
| SMILES | COc1cc(Nc2nc(N)c(-c3nc(-c4cc(NC(=O)C(=O)C5=CCCCC5)ccc4C)no3)s2)cc(OC)c1OC |
| InChI | InChI=1S/C29H30N6O6S/c1-15-10-11-17(31-27(37)22(36)16-8-6-5-7-9-16)12-19(15)26-34-28(41-35-26)24-25(30)33-29(42-24)32-18-13-20(38-2)23(40-4)21(14-18)39-3/h8,10-14H,5-7,9,30H2,1-4H3,(H,31,37)(H,32,33) |
| InChIKey | NEQRYSKQQLNJKL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 163.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.66 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|