C31H32N6O5S — CID 21358465
N-[3-[5-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,2,4-oxadiazol-3-yl]-4-methylphenyl]-3-(4-methylphenyl)propanamide (PubChem CID 21358465) has the molecular formula C31H32N6O5S and a molecular weight of 600.70 g/mol. Its IUPAC name is N-[3-[5-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,2,4-oxadiazol-3-yl]-4-methylphenyl]-3-(4-methylphenyl)propanamide.
| Compound Name | N-[3-[5-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,2,4-oxadiazol-3-yl]-4-methylphenyl]-3-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 21358465 |
| Molecular Formula | C31H32N6O5S |
| Molecular Weight | 600.70 g/mol |
| Exact Mass | 600.22 |
| IUPAC Name | N-[3-[5-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,2,4-oxadiazol-3-yl]-4-methylphenyl]-3-(4-methylphenyl)propanamide |
| SMILES | COc1cc(Nc2nc(N)c(-c3nc(-c4cc(NC(=O)CCc5ccc(C)cc5)ccc4C)no3)s2)cc(OC)c1OC |
| InChI | InChI=1S/C31H32N6O5S/c1-17-6-9-19(10-7-17)11-13-25(38)33-20-12-8-18(2)22(14-20)29-36-30(42-37-29)27-28(32)35-31(43-27)34-21-15-23(39-3)26(41-5)24(16-21)40-4/h6-10,12,14-16H,11,13,32H2,1-5H3,(H,33,38)(H,34,35) |
| InChIKey | OXYFPKXPMGUGIA-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 146.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.70 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |