C28H26N6O7S — CID 21358469
N-[3-[5-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,2,4-oxadiazol-3-yl]-4-methylphenyl]-4-methyl-6-oxopyran-2-carboxamide (PubChem CID 21358469) has the molecular formula C28H26N6O7S and a molecular weight of 590.62 g/mol. Its IUPAC name is N-[3-[5-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,2,4-oxadiazol-3-yl]-4-methylphenyl]-4-methyl-6-oxopyran-2-carboxamide.
| Compound Name | N-[3-[5-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,2,4-oxadiazol-3-yl]-4-methylphenyl]-4-methyl-6-oxopyran-2-carboxamide |
|---|---|
| PubChem CID | 21358469 |
| Molecular Formula | C28H26N6O7S |
| Molecular Weight | 590.62 g/mol |
| Exact Mass | 590.16 |
| IUPAC Name | N-[3-[5-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,2,4-oxadiazol-3-yl]-4-methylphenyl]-4-methyl-6-oxopyran-2-carboxamide |
| SMILES | COc1cc(Nc2nc(N)c(-c3nc(-c4cc(NC(=O)c5cc(C)cc(=O)o5)ccc4C)no3)s2)cc(OC)c1OC |
| InChI | InChI=1S/C28H26N6O7S/c1-13-8-20(40-21(35)9-13)26(36)30-15-7-6-14(2)17(10-15)25-33-27(41-34-25)23-24(29)32-28(42-23)31-16-11-18(37-3)22(39-5)19(12-16)38-4/h6-12H,29H2,1-5H3,(H,30,36)(H,31,32) |
| InChIKey | GFHYXTFWGRNQNU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 176.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.62 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |