C27H22Cl2N6O5S — CID 21358406
N-[3-[5-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,2,4-oxadiazol-3-yl]-4-chlorophenyl]-3-chlorobenzamide (PubChem CID 21358406) has the molecular formula C27H22Cl2N6O5S and a molecular weight of 613.48 g/mol. Its IUPAC name is N-[3-[5-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,2,4-oxadiazol-3-yl]-4-chlorophenyl]-3-chlorobenzamide.
| Compound Name | N-[3-[5-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,2,4-oxadiazol-3-yl]-4-chlorophenyl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 21358406 |
| Molecular Formula | C27H22Cl2N6O5S |
| Molecular Weight | 613.48 g/mol |
| Exact Mass | 612.07 |
| IUPAC Name | N-[3-[5-[4-amino-2-(3,4,5-trimethoxyanilino)-1,3-thiazol-5-yl]-1,2,4-oxadiazol-3-yl]-4-chlorophenyl]-3-chlorobenzamide |
| SMILES | COc1cc(Nc2nc(N)c(-c3nc(-c4cc(NC(=O)c5cccc(Cl)c5)ccc4Cl)no3)s2)cc(OC)c1OC |
| InChI | InChI=1S/C27H22Cl2N6O5S/c1-37-19-11-16(12-20(38-2)21(19)39-3)32-27-33-23(30)22(41-27)26-34-24(35-40-26)17-10-15(7-8-18(17)29)31-25(36)13-5-4-6-14(28)9-13/h4-12H,30H2,1-3H3,(H,31,36)(H,32,33) |
| InChIKey | ZTLUDKLBGUUNDO-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 146.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.48 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |