C11H20F6O2Si — CID 21365446
dimethyl-propyl-[4,4,4-trifluoro-3-methoxy-3-(trifluoromethyl)butoxy]silane (PubChem CID 21365446) has the molecular formula C11H20F6O2Si and a molecular weight of 326.35 g/mol. Its IUPAC name is dimethyl-propyl-[4,4,4-trifluoro-3-methoxy-3-(trifluoromethyl)butoxy]silane.
| Compound Name | dimethyl-propyl-[4,4,4-trifluoro-3-methoxy-3-(trifluoromethyl)butoxy]silane |
|---|---|
| PubChem CID | 21365446 |
| Molecular Formula | C11H20F6O2Si |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | dimethyl-propyl-[4,4,4-trifluoro-3-methoxy-3-(trifluoromethyl)butoxy]silane |
| SMILES | CCC[Si](C)(C)OCCC(OC)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H20F6O2Si/c1-5-8-20(3,4)19-7-6-9(18-2,10(12,13)14)11(15,16)17/h5-8H2,1-4H3 |
| InChIKey | JCIVHGPCGNOSJB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|