C27H8Cl8N2O4 — CID 21388019
4,5,6,7-tetrachloro-2-[4-methyl-2-(4,5,6,7-tetrachloro-1,3-dioxoinden-2-yl)quinolin-8-yl]isoindole-1,3-dione (PubChem CID 21388019) has the molecular formula C27H8Cl8N2O4 and a molecular weight of 708.00 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-[4-methyl-2-(4,5,6,7-tetrachloro-1,3-dioxoinden-2-yl)quinolin-8-yl]isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrachloro-2-[4-methyl-2-(4,5,6,7-tetrachloro-1,3-dioxoinden-2-yl)quinolin-8-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 21388019 |
| Molecular Formula | C27H8Cl8N2O4 |
| Molecular Weight | 708.00 g/mol |
| Exact Mass | 703.80 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-[4-methyl-2-(4,5,6,7-tetrachloro-1,3-dioxoinden-2-yl)quinolin-8-yl]isoindole-1,3-dione |
| SMILES | Cc1cc(C2C(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C2=O)nc2c(N3C(=O)c4c(Cl)c(Cl)c(Cl)c(Cl)c4C3=O)cccc12 |
| InChI | InChI=1S/C27H8Cl8N2O4/c1-6-5-8(10-24(38)11-12(25(10)39)16(29)20(33)19(32)15(11)28)36-23-7(6)3-2-4-9(23)37-26(40)13-14(27(37)41)18(31)22(35)21(34)17(13)30/h2-5,10H,1H3 |
| InChIKey | ONYOSBOZNPZTOJ-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 84.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.00 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|