C11H13N3O3 — CID 21388242
7-methoxy-1-oxido-3-propan-2-yloxy-1,2,4-benzotriazin-1-ium (PubChem CID 21388242) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 7-methoxy-1-oxido-3-propan-2-yloxy-1,2,4-benzotriazin-1-ium.
| Compound Name | 7-methoxy-1-oxido-3-propan-2-yloxy-1,2,4-benzotriazin-1-ium |
|---|---|
| PubChem CID | 21388242 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 7-methoxy-1-oxido-3-propan-2-yloxy-1,2,4-benzotriazin-1-ium |
| SMILES | COc1ccc2nc(OC(C)C)n[n+]([O-])c2c1 |
| InChI | InChI=1S/C11H13N3O3/c1-7(2)17-11-12-9-5-4-8(16-3)6-10(9)14(15)13-11/h4-7H,1-3H3 |
| InChIKey | DJLBEUPXHGNUCZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 71.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|