C16H12ClNO5 — CID 21389231
ethyl 8-chloro-1-methyl-4,10-dioxochromeno[3,2-b]pyridine-3-carboxylate (PubChem CID 21389231) has the molecular formula C16H12ClNO5 and a molecular weight of 333.73 g/mol. Its IUPAC name is ethyl 8-chloro-1-methyl-4,10-dioxochromeno[3,2-b]pyridine-3-carboxylate.
| Compound Name | ethyl 8-chloro-1-methyl-4,10-dioxochromeno[3,2-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 21389231 |
| Molecular Formula | C16H12ClNO5 |
| Molecular Weight | 333.73 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | ethyl 8-chloro-1-methyl-4,10-dioxochromeno[3,2-b]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C)c2c(=O)c3cc(Cl)ccc3oc2c1=O |
| InChI | InChI=1S/C16H12ClNO5/c1-3-22-16(21)10-7-18(2)12-13(19)9-6-8(17)4-5-11(9)23-15(12)14(10)20/h4-7H,3H2,1-2H3 |
| InChIKey | HSGOJWKOHYYEBA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 78.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.73 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|