About 1-butyl-8-chloro-4,10-dioxochromeno[3,2-b]pyridine-3-carboxylic acid
1-butyl-8-chloro-4,10-dioxochromeno[3,2-b]pyridine-3-carboxylic acid (PubChem CID 21389227) has the molecular formula C17H14ClNO5
and a molecular weight of 347.75 g/mol. Its IUPAC name is 1-butyl-8-chloro-4,10-dioxochromeno[3,2-b]pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-butyl-8-chloro-4,10-dioxochromeno[3,2-b]pyridine-3-carboxylic acid |
| PubChem CID | 21389227 |
| Molecular Formula | C17H14ClNO5 |
| Molecular Weight | 347.75 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 1-butyl-8-chloro-4,10-dioxochromeno[3,2-b]pyridine-3-carboxylic acid |
| SMILES | CCCCn1cc(C(=O)O)c(=O)c2oc3ccc(Cl)cc3c(=O)c21 |
| InChI | InChI=1S/C17H14ClNO5/c1-2-3-6-19-8-11(17(22)23)15(21)16-13(19)14(20)10-7-9(18)4-5-12(10)24-16/h4-5,7-8H,2-3,6H2,1H3,(H,22,23) |
| InChIKey | IXGGJGCGVSNSDE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.75 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-8-chloro-4,10-dioxochromeno[3,2-b]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-8-chloro-4,10-dioxochromeno[3,2-b]pyridine-3-carboxylic acid?
The IUPAC name of 1-butyl-8-chloro-4,10-dioxochromeno[3,2-b]pyridine-3-carboxylic acid (CID 21389227) is 1-butyl-8-chloro-4,10-dioxochromeno[3,2-b]pyridine-3-carboxylic acid.
What is the SMILES notation for 1-butyl-8-chloro-4,10-dioxochromeno[3,2-b]pyridine-3-carboxylic acid?
The canonical SMILES for 1-butyl-8-chloro-4,10-dioxochromeno[3,2-b]pyridine-3-carboxylic acid is CCCCn1cc(C(=O)O)c(=O)c2oc3ccc(Cl)cc3c(=O)c21.
What is the InChIKey of 1-butyl-8-chloro-4,10-dioxochromeno[3,2-b]pyridine-3-carboxylic acid?
The InChIKey is IXGGJGCGVSNSDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14ClNO5/c1-2-3-6-19-8-11(17(22)23)15(21)16-13(19)14(20)10-7-9(18)4-5-12(10)24-16/h4-5,7-8H,2-3,6H2,1H3,(H,22,23).
What are the key properties of 1-butyl-8-chloro-4,10-dioxochromeno[3,2-b]pyridine-3-carboxylic acid?
1-butyl-8-chloro-4,10-dioxochromeno[3,2-b]pyridine-3-carboxylic acid has a molecular weight of 347.75 g/mol, XLogP of 3.26, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-8-chloro-4,10-dioxochromeno[3,2-b]pyridine-3-carboxylic acid is sourced from PubChem (CID 21389227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).