C13H16N8O2S2 — CID 21390853
5-(1-methyl-5-nitroimidazol-2-yl)-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-3H-thiadiazole (PubChem CID 21390853) has the molecular formula C13H16N8O2S2 and a molecular weight of 380.46 g/mol. Its IUPAC name is 5-(1-methyl-5-nitroimidazol-2-yl)-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-3H-thiadiazole.
| Compound Name | 5-(1-methyl-5-nitroimidazol-2-yl)-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-3H-thiadiazole |
|---|---|
| PubChem CID | 21390853 |
| Molecular Formula | C13H16N8O2S2 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 5-(1-methyl-5-nitroimidazol-2-yl)-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-3H-thiadiazole |
| SMILES | Cn1c([N+](=O)[O-])cnc1C1=CNN(N2CCN(c3nccs3)CC2)S1 |
| InChI | InChI=1S/C13H16N8O2S2/c1-17-11(20(22)23)9-15-12(17)10-8-16-21(25-10)19-5-3-18(4-6-19)13-14-2-7-24-13/h2,7-9,16H,3-6H2,1H3 |
| InChIKey | VOGVRJKSDBERJA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|