C16H22ClN3S — CID 21397059
N-[3-(1H-indol-3-ylsulfanyl)propyl]-1-methylpyrrolidin-2-imine;hydrochloride (PubChem CID 21397059) has the molecular formula C16H22ClN3S and a molecular weight of 323.89 g/mol. Its IUPAC name is N-[3-(1H-indol-3-ylsulfanyl)propyl]-1-methylpyrrolidin-2-imine;hydrochloride.
| Compound Name | N-[3-(1H-indol-3-ylsulfanyl)propyl]-1-methylpyrrolidin-2-imine;hydrochloride |
|---|---|
| PubChem CID | 21397059 |
| Molecular Formula | C16H22ClN3S |
| Molecular Weight | 323.89 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | N-[3-(1H-indol-3-ylsulfanyl)propyl]-1-methylpyrrolidin-2-imine;hydrochloride |
| SMILES | CN1CCC/C1=N/CCCSc1c[nH]c2ccccc12.Cl |
| InChI | InChI=1S/C16H21N3S.ClH/c1-19-10-4-8-16(19)17-9-5-11-20-15-12-18-14-7-3-2-6-13(14)15;/h2-3,6-7,12,18H,4-5,8-11H2,1H3;1H/b17-16-; |
| InChIKey | NFXNENDXAMVVOF-XYJRJTJESA-N |
| XLogP | 4.20 |
| TPSA | 31.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.89 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|