C10H12O6 — CID 21406606
3,5-dihydroperoxy-3-methyl-5-phenyldioxolane (PubChem CID 21406606) has the molecular formula C10H12O6 and a molecular weight of 228.20 g/mol. Its IUPAC name is 3,5-dihydroperoxy-3-methyl-5-phenyldioxolane.
| Compound Name | 3,5-dihydroperoxy-3-methyl-5-phenyldioxolane |
|---|---|
| PubChem CID | 21406606 |
| Molecular Formula | C10H12O6 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 3,5-dihydroperoxy-3-methyl-5-phenyldioxolane |
| SMILES | CC1(OO)CC(OO)(c2ccccc2)OO1 |
| InChI | InChI=1S/C10H12O6/c1-9(13-11)7-10(14-12,16-15-9)8-5-3-2-4-6-8/h2-6,11-12H,7H2,1H3 |
| InChIKey | YCGOATQHQYLMHV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|