C23H22O4 — CID 10690019
3-hydroperoxy-4,4-dimethyl-3,5,5-triphenyldioxolane (PubChem CID 10690019) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-hydroperoxy-4,4-dimethyl-3,5,5-triphenyldioxolane.
| Compound Name | 3-hydroperoxy-4,4-dimethyl-3,5,5-triphenyldioxolane |
|---|---|
| PubChem CID | 10690019 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 3-hydroperoxy-4,4-dimethyl-3,5,5-triphenyldioxolane |
| SMILES | CC1(C)C(OO)(c2ccccc2)OOC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H22O4/c1-21(2)22(18-12-6-3-7-13-18,19-14-8-4-9-15-19)26-27-23(21,25-24)20-16-10-5-11-17-20/h3-17,24H,1-2H3 |
| InChIKey | SOFDNGDPZASKIX-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|