About 3-bromo-5-hydroperoxy-4,4-dimethyl-3,5-diphenylpyrazole
3-bromo-5-hydroperoxy-4,4-dimethyl-3,5-diphenylpyrazole (PubChem CID 5256407) has the molecular formula C17H17BrN2O2
and a molecular weight of 361.24 g/mol. Its IUPAC name is 3-bromo-5-hydroperoxy-4,4-dimethyl-3,5-diphenylpyrazole.
Molecular Properties
| Compound Name | 3-bromo-5-hydroperoxy-4,4-dimethyl-3,5-diphenylpyrazole |
| PubChem CID | 5256407 |
| Molecular Formula | C17H17BrN2O2 |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 3-bromo-5-hydroperoxy-4,4-dimethyl-3,5-diphenylpyrazole |
| SMILES | CC1(C)C(Br)(c2ccccc2)N=NC1(OO)c1ccccc1 |
| InChI | InChI=1S/C17H17BrN2O2/c1-15(2)16(18,13-9-5-3-6-10-13)19-20-17(15,22-21)14-11-7-4-8-12-14/h3-12,21H,1-2H3 |
| InChIKey | ILEBBQQJCCKNNC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-5-hydroperoxy-4,4-dimethyl-3,5-diphenylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-hydroperoxy-4,4-dimethyl-3,5-diphenylpyrazole?
The IUPAC name of 3-bromo-5-hydroperoxy-4,4-dimethyl-3,5-diphenylpyrazole (CID 5256407) is 3-bromo-5-hydroperoxy-4,4-dimethyl-3,5-diphenylpyrazole.
What is the SMILES notation for 3-bromo-5-hydroperoxy-4,4-dimethyl-3,5-diphenylpyrazole?
The canonical SMILES for 3-bromo-5-hydroperoxy-4,4-dimethyl-3,5-diphenylpyrazole is CC1(C)C(Br)(c2ccccc2)N=NC1(OO)c1ccccc1.
What is the InChIKey of 3-bromo-5-hydroperoxy-4,4-dimethyl-3,5-diphenylpyrazole?
The InChIKey is ILEBBQQJCCKNNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17BrN2O2/c1-15(2)16(18,13-9-5-3-6-10-13)19-20-17(15,22-21)14-11-7-4-8-12-14/h3-12,21H,1-2H3.
What are the key properties of 3-bromo-5-hydroperoxy-4,4-dimethyl-3,5-diphenylpyrazole?
3-bromo-5-hydroperoxy-4,4-dimethyl-3,5-diphenylpyrazole has a molecular weight of 361.24 g/mol, XLogP of 5.07, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-hydroperoxy-4,4-dimethyl-3,5-diphenylpyrazole is sourced from PubChem (CID 5256407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).