C23H24N4O4S — CID 21414459
[1-but-3-ynyl-3-oxido-3-(6-propoxy-1,3-benzothiazol-2-yl)imidazolidin-3-ium-4-yl] pyridine-3-carboxylate (PubChem CID 21414459) has the molecular formula C23H24N4O4S and a molecular weight of 452.54 g/mol. Its IUPAC name is [1-but-3-ynyl-3-oxido-3-(6-propoxy-1,3-benzothiazol-2-yl)imidazolidin-3-ium-4-yl] pyridine-3-carboxylate.
| Compound Name | [1-but-3-ynyl-3-oxido-3-(6-propoxy-1,3-benzothiazol-2-yl)imidazolidin-3-ium-4-yl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 21414459 |
| Molecular Formula | C23H24N4O4S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | [1-but-3-ynyl-3-oxido-3-(6-propoxy-1,3-benzothiazol-2-yl)imidazolidin-3-ium-4-yl] pyridine-3-carboxylate |
| SMILES | C#CCCN1CC(OC(=O)c2cccnc2)[N+]([O-])(c2nc3ccc(OCCC)cc3s2)C1 |
| InChI | InChI=1S/C23H24N4O4S/c1-3-5-11-26-15-21(31-22(28)17-7-6-10-24-14-17)27(29,16-26)23-25-19-9-8-18(30-12-4-2)13-20(19)32-23/h1,6-10,13-14,21H,4-5,11-12,15-16H2,2H3 |
| InChIKey | VOWFFYKILXGCPQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|