C20H21N3O4S — CID 21401426
[3-(1,3-benzothiazol-2-yl)-1-methyl-3-oxidoimidazolidin-3-ium-4-yl] 4-ethoxybenzoate (PubChem CID 21401426) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is [3-(1,3-benzothiazol-2-yl)-1-methyl-3-oxidoimidazolidin-3-ium-4-yl] 4-ethoxybenzoate.
| Compound Name | [3-(1,3-benzothiazol-2-yl)-1-methyl-3-oxidoimidazolidin-3-ium-4-yl] 4-ethoxybenzoate |
|---|---|
| PubChem CID | 21401426 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | [3-(1,3-benzothiazol-2-yl)-1-methyl-3-oxidoimidazolidin-3-ium-4-yl] 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OC2CN(C)C[N+]2([O-])c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C20H21N3O4S/c1-3-26-15-10-8-14(9-11-15)19(24)27-18-12-22(2)13-23(18,25)20-21-16-6-4-5-7-17(16)28-20/h4-11,18H,3,12-13H2,1-2H3 |
| InChIKey | DKSMFHJAUKBSLA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|