C18H25N5O3S2 — CID 21425741
[3-(5-hexylsulfanyl-1,3,4-thiadiazol-2-yl)-1-methyl-3-oxidoimidazolidin-3-ium-4-yl] pyridine-3-carboxylate (PubChem CID 21425741) has the molecular formula C18H25N5O3S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is [3-(5-hexylsulfanyl-1,3,4-thiadiazol-2-yl)-1-methyl-3-oxidoimidazolidin-3-ium-4-yl] pyridine-3-carboxylate.
| Compound Name | [3-(5-hexylsulfanyl-1,3,4-thiadiazol-2-yl)-1-methyl-3-oxidoimidazolidin-3-ium-4-yl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 21425741 |
| Molecular Formula | C18H25N5O3S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | [3-(5-hexylsulfanyl-1,3,4-thiadiazol-2-yl)-1-methyl-3-oxidoimidazolidin-3-ium-4-yl] pyridine-3-carboxylate |
| SMILES | CCCCCCSc1nnc([N+]2([O-])CN(C)CC2OC(=O)c2cccnc2)s1 |
| InChI | InChI=1S/C18H25N5O3S2/c1-3-4-5-6-10-27-18-21-20-17(28-18)23(25)13-22(2)12-15(23)26-16(24)14-8-7-9-19-11-14/h7-9,11,15H,3-6,10,12-13H2,1-2H3 |
| InChIKey | KUMMLOIQZPXCCH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 91.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|