C20H28ClN5O4S — CID 88817294
[1-(3-chloropropyl)-3-(5-hexoxy-1,3,4-thiadiazol-2-yl)-3-oxidoimidazolidin-3-ium-4-yl] pyridine-3-carboxylate (PubChem CID 88817294) has the molecular formula C20H28ClN5O4S and a molecular weight of 470.00 g/mol. Its IUPAC name is [1-(3-chloropropyl)-3-(5-hexoxy-1,3,4-thiadiazol-2-yl)-3-oxidoimidazolidin-3-ium-4-yl] pyridine-3-carboxylate.
| Compound Name | [1-(3-chloropropyl)-3-(5-hexoxy-1,3,4-thiadiazol-2-yl)-3-oxidoimidazolidin-3-ium-4-yl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 88817294 |
| Molecular Formula | C20H28ClN5O4S |
| Molecular Weight | 470.00 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | [1-(3-chloropropyl)-3-(5-hexoxy-1,3,4-thiadiazol-2-yl)-3-oxidoimidazolidin-3-ium-4-yl] pyridine-3-carboxylate |
| SMILES | CCCCCCOc1nnc([N+]2([O-])CN(CCCCl)CC2OC(=O)c2cccnc2)s1 |
| InChI | InChI=1S/C20H28ClN5O4S/c1-2-3-4-5-12-29-20-24-23-19(31-20)26(28)15-25(11-7-9-21)14-17(26)30-18(27)16-8-6-10-22-13-16/h6,8,10,13,17H,2-5,7,9,11-12,14-15H2,1H3 |
| InChIKey | GEMQFHUVSPTTGS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 100.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.00 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|