C13H15N3O3S — CID 21401447
[1-(1,3-benzothiazol-2-yl)-3-methyl-1-oxidoimidazolidin-1-ium-2-yl] acetate (PubChem CID 21401447) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is [1-(1,3-benzothiazol-2-yl)-3-methyl-1-oxidoimidazolidin-1-ium-2-yl] acetate.
| Compound Name | [1-(1,3-benzothiazol-2-yl)-3-methyl-1-oxidoimidazolidin-1-ium-2-yl] acetate |
|---|---|
| PubChem CID | 21401447 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | [1-(1,3-benzothiazol-2-yl)-3-methyl-1-oxidoimidazolidin-1-ium-2-yl] acetate |
| SMILES | CC(=O)OC1N(C)CC[N+]1([O-])c1nc2ccccc2s1 |
| InChI | InChI=1S/C13H15N3O3S/c1-9(17)19-13-15(2)7-8-16(13,18)12-14-10-5-3-4-6-11(10)20-12/h3-6,13H,7-8H2,1-2H3 |
| InChIKey | MMAMUKYGZKDBBX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|