C15H20N3OS+ — CID 57063412
1-[1-(1,3-benzothiazol-2-yl)-4-(methylamino)piperidin-1-ium-1-yl]ethanone (PubChem CID 57063412) has the molecular formula C15H20N3OS+ and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-[1-(1,3-benzothiazol-2-yl)-4-(methylamino)piperidin-1-ium-1-yl]ethanone.
| Compound Name | 1-[1-(1,3-benzothiazol-2-yl)-4-(methylamino)piperidin-1-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 57063412 |
| Molecular Formula | C15H20N3OS+ |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 1-[1-(1,3-benzothiazol-2-yl)-4-(methylamino)piperidin-1-ium-1-yl]ethanone |
| SMILES | CNC1CC[N+](C(C)=O)(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C15H20N3OS/c1-11(19)18(9-7-12(16-2)8-10-18)15-17-13-5-3-4-6-14(13)20-15/h3-6,12,16H,7-10H2,1-2H3/q+1 |
| InChIKey | BLOHPVQFFJFKME-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|