C31H54O3S — CID 21438768
10-[4-hydroxy-3,5-bis(2-methylpentan-2-yl)phenyl]decyl 3-sulfanylpropanoate (PubChem CID 21438768) has the molecular formula C31H54O3S and a molecular weight of 506.84 g/mol. Its IUPAC name is 10-[4-hydroxy-3,5-bis(2-methylpentan-2-yl)phenyl]decyl 3-sulfanylpropanoate.
| Compound Name | 10-[4-hydroxy-3,5-bis(2-methylpentan-2-yl)phenyl]decyl 3-sulfanylpropanoate |
|---|---|
| PubChem CID | 21438768 |
| Molecular Formula | C31H54O3S |
| Molecular Weight | 506.84 g/mol |
| Exact Mass | 506.38 |
| IUPAC Name | 10-[4-hydroxy-3,5-bis(2-methylpentan-2-yl)phenyl]decyl 3-sulfanylpropanoate |
| SMILES | CCCC(C)(C)c1cc(CCCCCCCCCCOC(=O)CCS)cc(C(C)(C)CCC)c1O |
| InChI | InChI=1S/C31H54O3S/c1-7-19-30(3,4)26-23-25(24-27(29(26)33)31(5,6)20-8-2)17-15-13-11-9-10-12-14-16-21-34-28(32)18-22-35/h23-24,33,35H,7-22H2,1-6H3 |
| InChIKey | XEWNLLUZTFEKKF-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.84 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|