C21H22ClN5O3S — CID 21442756
7-(2-chlorophenyl)-4-ethyl-9-methoxy-N-(2-methoxyethyl)-3-thia-1,8,11,13-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene-12-carboxamide (PubChem CID 21442756) has the molecular formula C21H22ClN5O3S and a molecular weight of 459.96 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-4-ethyl-9-methoxy-N-(2-methoxyethyl)-3-thia-1,8,11,13-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene-12-carboxamide.
| Compound Name | 7-(2-chlorophenyl)-4-ethyl-9-methoxy-N-(2-methoxyethyl)-3-thia-1,8,11,13-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene-12-carboxamide |
|---|---|
| PubChem CID | 21442756 |
| Molecular Formula | C21H22ClN5O3S |
| Molecular Weight | 459.96 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 7-(2-chlorophenyl)-4-ethyl-9-methoxy-N-(2-methoxyethyl)-3-thia-1,8,11,13-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene-12-carboxamide |
| SMILES | CCc1cc2c(s1)-n1nc(C(=O)NCCOC)nc1C(OC)N=C2c1ccccc1Cl |
| InChI | InChI=1S/C21H22ClN5O3S/c1-4-12-11-14-16(13-7-5-6-8-15(13)22)24-20(30-3)18-25-17(19(28)23-9-10-29-2)26-27(18)21(14)31-12/h5-8,11,20H,4,9-10H2,1-3H3,(H,23,28) |
| InChIKey | NPSFEBPGIXTMKU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.96 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|