About (5,5-dimethyl-3-oxooxolan-2-yl) 2,2-dimethylpropanoate
(5,5-dimethyl-3-oxooxolan-2-yl) 2,2-dimethylpropanoate (PubChem CID 21465708) has the molecular formula C11H18O4
and a molecular weight of 214.26 g/mol. Its IUPAC name is (5,5-dimethyl-3-oxooxolan-2-yl) 2,2-dimethylpropanoate.
Analyze (5,5-dimethyl-3-oxooxolan-2-yl) 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,5-dimethyl-3-oxooxolan-2-yl) 2,2-dimethylpropanoate?
The IUPAC name of (5,5-dimethyl-3-oxooxolan-2-yl) 2,2-dimethylpropanoate (CID 21465708) is (5,5-dimethyl-3-oxooxolan-2-yl) 2,2-dimethylpropanoate.
What is the SMILES notation for (5,5-dimethyl-3-oxooxolan-2-yl) 2,2-dimethylpropanoate?
The canonical SMILES for (5,5-dimethyl-3-oxooxolan-2-yl) 2,2-dimethylpropanoate is CC1(C)CC(=O)C(OC(=O)C(C)(C)C)O1.
What is the InChIKey of (5,5-dimethyl-3-oxooxolan-2-yl) 2,2-dimethylpropanoate?
The InChIKey is ZABFNJDGFIIJFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4/c1-10(2,3)9(13)14-8-7(12)6-11(4,5)15-8/h8H,6H2,1-5H3.
What are the key properties of (5,5-dimethyl-3-oxooxolan-2-yl) 2,2-dimethylpropanoate?
(5,5-dimethyl-3-oxooxolan-2-yl) 2,2-dimethylpropanoate has a molecular weight of 214.26 g/mol, XLogP of 1.67, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5,5-dimethyl-3-oxooxolan-2-yl) 2,2-dimethylpropanoate is sourced from PubChem (CID 21465708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).