About benzyl 4-amino-4-oxobutanoate
benzyl 4-amino-4-oxobutanoate (PubChem CID 21470073) has the molecular formula C11H13NO3
and a molecular weight of 207.23 g/mol. Its IUPAC name is benzyl 4-amino-4-oxobutanoate.
Molecular Properties
| Compound Name | benzyl 4-amino-4-oxobutanoate |
| PubChem CID | 21470073 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | benzyl 4-amino-4-oxobutanoate |
| SMILES | NC(=O)CCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C11H13NO3/c12-10(13)6-7-11(14)15-8-9-4-2-1-3-5-9/h1-5H,6-8H2,(H2,12,13) |
| InChIKey | ZLSTXEBTAJKDKH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl 4-amino-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-amino-4-oxobutanoate?
The IUPAC name of benzyl 4-amino-4-oxobutanoate (CID 21470073) is benzyl 4-amino-4-oxobutanoate.
What is the SMILES notation for benzyl 4-amino-4-oxobutanoate?
The canonical SMILES for benzyl 4-amino-4-oxobutanoate is NC(=O)CCC(=O)OCc1ccccc1.
What is the InChIKey of benzyl 4-amino-4-oxobutanoate?
The InChIKey is ZLSTXEBTAJKDKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3/c12-10(13)6-7-11(14)15-8-9-4-2-1-3-5-9/h1-5H,6-8H2,(H2,12,13).
What are the key properties of benzyl 4-amino-4-oxobutanoate?
benzyl 4-amino-4-oxobutanoate has a molecular weight of 207.23 g/mol, XLogP of 1.00, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-amino-4-oxobutanoate is sourced from PubChem (CID 21470073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).