About bis(2-ethoxypentyl) diethyl silicate
bis(2-ethoxypentyl) diethyl silicate (PubChem CID 21479517) has the molecular formula C18H40O6Si
and a molecular weight of 380.60 g/mol. Its IUPAC name is bis(2-ethoxypentyl) diethyl silicate.
Molecular Properties
| Compound Name | bis(2-ethoxypentyl) diethyl silicate |
| PubChem CID | 21479517 |
| Molecular Formula | C18H40O6Si |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | bis(2-ethoxypentyl) diethyl silicate |
| SMILES | CCCC(CO[Si](OCC)(OCC)OCC(CCC)OCC)OCC |
| InChI | InChI=1S/C18H40O6Si/c1-7-13-17(19-9-3)15-23-25(21-11-5,22-12-6)24-16-18(14-8-2)20-10-4/h17-18H,7-16H2,1-6H3 |
| InChIKey | OUJQOTFMRODLPP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(2-ethoxypentyl) diethyl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-ethoxypentyl) diethyl silicate?
The IUPAC name of bis(2-ethoxypentyl) diethyl silicate (CID 21479517) is bis(2-ethoxypentyl) diethyl silicate.
What is the SMILES notation for bis(2-ethoxypentyl) diethyl silicate?
The canonical SMILES for bis(2-ethoxypentyl) diethyl silicate is CCCC(CO[Si](OCC)(OCC)OCC(CCC)OCC)OCC.
What is the InChIKey of bis(2-ethoxypentyl) diethyl silicate?
The InChIKey is OUJQOTFMRODLPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H40O6Si/c1-7-13-17(19-9-3)15-23-25(21-11-5,22-12-6)24-16-18(14-8-2)20-10-4/h17-18H,7-16H2,1-6H3.
What are the key properties of bis(2-ethoxypentyl) diethyl silicate?
bis(2-ethoxypentyl) diethyl silicate has a molecular weight of 380.60 g/mol, XLogP of 3.94, 18 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-ethoxypentyl) diethyl silicate is sourced from PubChem (CID 21479517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).