C26H23Cl2N3O4 — CID 21483117
3-tert-butyl-N-[4-[cyano-(2,4-dichlorophenyl)methyl]phenyl]-2-hydroxy-6-methyl-5-nitrobenzamide (PubChem CID 21483117) has the molecular formula C26H23Cl2N3O4 and a molecular weight of 512.39 g/mol. Its IUPAC name is 3-tert-butyl-N-[4-[cyano-(2,4-dichlorophenyl)methyl]phenyl]-2-hydroxy-6-methyl-5-nitrobenzamide.
| Compound Name | 3-tert-butyl-N-[4-[cyano-(2,4-dichlorophenyl)methyl]phenyl]-2-hydroxy-6-methyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 21483117 |
| Molecular Formula | C26H23Cl2N3O4 |
| Molecular Weight | 512.39 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | 3-tert-butyl-N-[4-[cyano-(2,4-dichlorophenyl)methyl]phenyl]-2-hydroxy-6-methyl-5-nitrobenzamide |
| SMILES | Cc1c([N+](=O)[O-])cc(C(C)(C)C)c(O)c1C(=O)Nc1ccc(C(C#N)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C26H23Cl2N3O4/c1-14-22(31(34)35)12-20(26(2,3)4)24(32)23(14)25(33)30-17-8-5-15(6-9-17)19(13-29)18-10-7-16(27)11-21(18)28/h5-12,19,32H,1-4H3,(H,30,33) |
| InChIKey | HIWNNMLXSKFQMI-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 116.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.39 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|