C23H16F3N3O6 — CID 21483142
N-[4-[cyano-(4-methoxyphenyl)methyl]-3-(trifluoromethyl)phenyl]-2,6-dihydroxy-3-nitrobenzamide (PubChem CID 21483142) has the molecular formula C23H16F3N3O6 and a molecular weight of 487.39 g/mol. Its IUPAC name is N-[4-[cyano-(4-methoxyphenyl)methyl]-3-(trifluoromethyl)phenyl]-2,6-dihydroxy-3-nitrobenzamide.
| Compound Name | N-[4-[cyano-(4-methoxyphenyl)methyl]-3-(trifluoromethyl)phenyl]-2,6-dihydroxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 21483142 |
| Molecular Formula | C23H16F3N3O6 |
| Molecular Weight | 487.39 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | N-[4-[cyano-(4-methoxyphenyl)methyl]-3-(trifluoromethyl)phenyl]-2,6-dihydroxy-3-nitrobenzamide |
| SMILES | COc1ccc(C(C#N)c2ccc(NC(=O)c3c(O)ccc([N+](=O)[O-])c3O)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H16F3N3O6/c1-35-14-5-2-12(3-6-14)16(11-27)15-7-4-13(10-17(15)23(24,25)26)28-22(32)20-19(30)9-8-18(21(20)31)29(33)34/h2-10,16,30-31H,1H3,(H,28,32) |
| InChIKey | LEBVVTZHVZERII-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 145.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.39 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|