C21H11Cl5N2O2 — CID 21483124
3,4,5-trichloro-N-[2-chloro-4-[(4-chlorophenyl)-cyanomethyl]phenyl]-2-hydroxybenzamide (PubChem CID 21483124) has the molecular formula C21H11Cl5N2O2 and a molecular weight of 500.60 g/mol. Its IUPAC name is 3,4,5-trichloro-N-[2-chloro-4-[(4-chlorophenyl)-cyanomethyl]phenyl]-2-hydroxybenzamide.
| Compound Name | 3,4,5-trichloro-N-[2-chloro-4-[(4-chlorophenyl)-cyanomethyl]phenyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 21483124 |
| Molecular Formula | C21H11Cl5N2O2 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 497.93 |
| IUPAC Name | 3,4,5-trichloro-N-[2-chloro-4-[(4-chlorophenyl)-cyanomethyl]phenyl]-2-hydroxybenzamide |
| SMILES | N#CC(c1ccc(Cl)cc1)c1ccc(NC(=O)c2cc(Cl)c(Cl)c(Cl)c2O)c(Cl)c1 |
| InChI | InChI=1S/C21H11Cl5N2O2/c22-12-4-1-10(2-5-12)14(9-27)11-3-6-17(15(23)7-11)28-21(30)13-8-16(24)18(25)19(26)20(13)29/h1-8,14,29H,(H,28,30) |
| InChIKey | NOHPUXNOPNEDOI-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|