C23H22N4O7S2 — CID 21492676
7-[(2-formamido-2-phenylacetyl)amino]-7-methoxy-3-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 21492676) has the molecular formula C23H22N4O7S2 and a molecular weight of 530.58 g/mol. Its IUPAC name is 7-[(2-formamido-2-phenylacetyl)amino]-7-methoxy-3-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | 7-[(2-formamido-2-phenylacetyl)amino]-7-methoxy-3-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 21492676 |
| Molecular Formula | C23H22N4O7S2 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | 7-[(2-formamido-2-phenylacetyl)amino]-7-methoxy-3-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | COC1(NC(=O)C(NC=O)c2ccccc2)C(=O)N2C(C(=O)O)=C(CSc3cccc[n+]3[O-])CSC21 |
| InChI | InChI=1S/C23H22N4O7S2/c1-34-23(25-19(29)17(24-13-28)14-7-3-2-4-8-14)21(32)27-18(20(30)31)15(12-36-22(23)27)11-35-16-9-5-6-10-26(16)33/h2-10,13,17,22H,11-12H2,1H3,(H,24,28)(H,25,29)(H,30,31) |
| InChIKey | PMNKHEVHVFCCJN-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|