C23H23N3O10S — CID 22793544
(6S,7S)-7-[[2-amino-4-(2-carboxy-1,3-dioxoinden-2-yl)butanoyl]amino]-3-(hydroxymethyl)-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 22793544) has the molecular formula C23H23N3O10S and a molecular weight of 533.52 g/mol. Its IUPAC name is (6S,7S)-7-[[2-amino-4-(2-carboxy-1,3-dioxoinden-2-yl)butanoyl]amino]-3-(hydroxymethyl)-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S,7S)-7-[[2-amino-4-(2-carboxy-1,3-dioxoinden-2-yl)butanoyl]amino]-3-(hydroxymethyl)-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 22793544 |
| Molecular Formula | C23H23N3O10S |
| Molecular Weight | 533.52 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | (6S,7S)-7-[[2-amino-4-(2-carboxy-1,3-dioxoinden-2-yl)butanoyl]amino]-3-(hydroxymethyl)-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CO[C@@]1(NC(=O)C(N)CCC2(C(=O)O)C(=O)c3ccccc3C2=O)C(=O)N2C(C(=O)O)=C(CO)CS[C@H]21 |
| InChI | InChI=1S/C23H23N3O10S/c1-36-23(19(33)26-14(18(31)32)10(8-27)9-37-20(23)26)25-17(30)13(24)6-7-22(21(34)35)15(28)11-4-2-3-5-12(11)16(22)29/h2-5,13,20,27H,6-9,24H2,1H3,(H,25,30)(H,31,32)(H,34,35)/t13?,20-,23-/m0/s1 |
| InChIKey | IRFIRUZSQMEHJB-ZXKZWWFOSA-N |
| XLogP | -1.05 |
| TPSA | 213.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.52 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|