C20H19BrN2O9S — CID 54168931
(6S)-3-(2-bromoethoxycarbonyl)-7-[(2-carboxy-2-phenylacetyl)amino]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 54168931) has the molecular formula C20H19BrN2O9S and a molecular weight of 543.35 g/mol. Its IUPAC name is (6S)-3-(2-bromoethoxycarbonyl)-7-[(2-carboxy-2-phenylacetyl)amino]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-3-(2-bromoethoxycarbonyl)-7-[(2-carboxy-2-phenylacetyl)amino]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 54168931 |
| Molecular Formula | C20H19BrN2O9S |
| Molecular Weight | 543.35 g/mol |
| Exact Mass | 542.00 |
| IUPAC Name | (6S)-3-(2-bromoethoxycarbonyl)-7-[(2-carboxy-2-phenylacetyl)amino]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | COC1(NC(=O)C(C(=O)O)c2ccccc2)C(=O)N2C(C(=O)O)=C(C(=O)OCCBr)CS[C@H]21 |
| InChI | InChI=1S/C20H19BrN2O9S/c1-31-20(22-14(24)12(15(25)26)10-5-3-2-4-6-10)18(30)23-13(16(27)28)11(9-33-19(20)23)17(29)32-8-7-21/h2-6,12,19H,7-9H2,1H3,(H,22,24)(H,25,26)(H,27,28)/t12?,19-,20?/m0/s1 |
| InChIKey | OTQKAFMKDCJIJA-GSBZXEOGSA-N |
| XLogP | 0.51 |
| TPSA | 159.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.35 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|