C20H18Cl3NO5 — CID 21494930
3-[1-anilino-2,5-dichloro-4-(chloromethyl)-4-methyl-1,3-dioxopentan-2-yl]oxybenzoic acid (PubChem CID 21494930) has the molecular formula C20H18Cl3NO5 and a molecular weight of 458.73 g/mol. Its IUPAC name is 3-[1-anilino-2,5-dichloro-4-(chloromethyl)-4-methyl-1,3-dioxopentan-2-yl]oxybenzoic acid.
| Compound Name | 3-[1-anilino-2,5-dichloro-4-(chloromethyl)-4-methyl-1,3-dioxopentan-2-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 21494930 |
| Molecular Formula | C20H18Cl3NO5 |
| Molecular Weight | 458.73 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | 3-[1-anilino-2,5-dichloro-4-(chloromethyl)-4-methyl-1,3-dioxopentan-2-yl]oxybenzoic acid |
| SMILES | CC(CCl)(CCl)C(=O)C(Cl)(Oc1cccc(C(=O)O)c1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H18Cl3NO5/c1-19(11-21,12-22)17(27)20(23,18(28)24-14-7-3-2-4-8-14)29-15-9-5-6-13(10-15)16(25)26/h2-10H,11-12H2,1H3,(H,24,28)(H,25,26) |
| InChIKey | JRJRMKCTIAEGFS-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.73 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|