C17H25N5O — CID 2174924
9-N-(4-butoxyphenyl)-6,8,10-triazaspiro[4.5]deca-6,9-diene-7,9-diamine (PubChem CID 2174924) has the molecular formula C17H25N5O and a molecular weight of 315.42 g/mol. Its IUPAC name is 9-N-(4-butoxyphenyl)-6,8,10-triazaspiro[4.5]deca-6,9-diene-7,9-diamine.
| Compound Name | 9-N-(4-butoxyphenyl)-6,8,10-triazaspiro[4.5]deca-6,9-diene-7,9-diamine |
|---|---|
| PubChem CID | 2174924 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | 9-N-(4-butoxyphenyl)-6,8,10-triazaspiro[4.5]deca-6,9-diene-7,9-diamine |
| SMILES | CCCCOc1ccc(NC2=NC3(CCCC3)N=C(N)N2)cc1 |
| InChI | InChI=1S/C17H25N5O/c1-2-3-12-23-14-8-6-13(7-9-14)19-16-20-15(18)21-17(22-16)10-4-5-11-17/h6-9H,2-5,10-12H2,1H3,(H4,18,19,20,21,22) |
| InChIKey | MCYRPUWJNNPZAT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 84.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|