C23H19ClN2O3S — CID 2179571
(5Z)-5-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 2179571) has the molecular formula C23H19ClN2O3S and a molecular weight of 438.94 g/mol. Its IUPAC name is (5Z)-5-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 2179571 |
| Molecular Formula | C23H19ClN2O3S |
| Molecular Weight | 438.94 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | (5Z)-5-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1ccc(N2C(=O)/C(=C/c3ccc(-c4ccc(Cl)cc4)o3)N(C)C2=S)cc1 |
| InChI | InChI=1S/C23H19ClN2O3S/c1-3-28-18-10-8-17(9-11-18)26-22(27)20(25(2)23(26)30)14-19-12-13-21(29-19)15-4-6-16(24)7-5-15/h4-14H,3H2,1-2H3/b20-14- |
| InChIKey | AGEPGTJKXYVTKL-ZHZULCJRSA-N |
| XLogP | 5.60 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.94 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|