C17H23NO3 — CID 2194966
(2S,6S)-4-[4-(4-methoxyphenoxy)but-2-ynyl]-2,6-dimethylmorpholine (PubChem CID 2194966) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is (2S,6S)-4-[4-(4-methoxyphenoxy)but-2-ynyl]-2,6-dimethylmorpholine.
| Compound Name | (2S,6S)-4-[4-(4-methoxyphenoxy)but-2-ynyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 2194966 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | (2S,6S)-4-[4-(4-methoxyphenoxy)but-2-ynyl]-2,6-dimethylmorpholine |
| SMILES | COc1ccc(OCC#CCN2C[C@H](C)O[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C17H23NO3/c1-14-12-18(13-15(2)21-14)10-4-5-11-20-17-8-6-16(19-3)7-9-17/h6-9,14-15H,10-13H2,1-3H3/t14-,15-/m0/s1 |
| InChIKey | SJHVBGUINXPXAF-GJZGRUSLSA-N |
| XLogP | 2.19 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|