C18H17Cl2N3O2 — CID 22004351
7-chloro-N-[(3-chloro-4-methoxyphenyl)methyl]-4-ethoxyphthalazin-1-amine (PubChem CID 22004351) has the molecular formula C18H17Cl2N3O2 and a molecular weight of 378.26 g/mol. Its IUPAC name is 7-chloro-N-[(3-chloro-4-methoxyphenyl)methyl]-4-ethoxyphthalazin-1-amine.
| Compound Name | 7-chloro-N-[(3-chloro-4-methoxyphenyl)methyl]-4-ethoxyphthalazin-1-amine |
|---|---|
| PubChem CID | 22004351 |
| Molecular Formula | C18H17Cl2N3O2 |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 7-chloro-N-[(3-chloro-4-methoxyphenyl)methyl]-4-ethoxyphthalazin-1-amine |
| SMILES | CCOc1nnc(NCc2ccc(OC)c(Cl)c2)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C18H17Cl2N3O2/c1-3-25-18-13-6-5-12(19)9-14(13)17(22-23-18)21-10-11-4-7-16(24-2)15(20)8-11/h4-9H,3,10H2,1-2H3,(H,21,22) |
| InChIKey | CGCANYSDTNESSG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |