C26H32F2O3 — CID 22011589
2-[4-[4-[difluoro-(4-propylphenyl)methoxy]phenyl]cyclohexyl]-1,3-dioxane (PubChem CID 22011589) has the molecular formula C26H32F2O3 and a molecular weight of 430.54 g/mol. Its IUPAC name is 2-[4-[4-[difluoro-(4-propylphenyl)methoxy]phenyl]cyclohexyl]-1,3-dioxane.
| Compound Name | 2-[4-[4-[difluoro-(4-propylphenyl)methoxy]phenyl]cyclohexyl]-1,3-dioxane |
|---|---|
| PubChem CID | 22011589 |
| Molecular Formula | C26H32F2O3 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 2-[4-[4-[difluoro-(4-propylphenyl)methoxy]phenyl]cyclohexyl]-1,3-dioxane |
| SMILES | CCCc1ccc(C(F)(F)Oc2ccc(C3CCC(C4OCCCO4)CC3)cc2)cc1 |
| InChI | InChI=1S/C26H32F2O3/c1-2-4-19-5-13-23(14-6-19)26(27,28)31-24-15-11-21(12-16-24)20-7-9-22(10-8-20)25-29-17-3-18-30-25/h5-6,11-16,20,22,25H,2-4,7-10,17-18H2,1H3 |
| InChIKey | KVCJCSIAGGHLHD-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |