C26H29F5 — CID 22045593
2-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethyl]-7-propyl-1,2,3,4,5,6,7,8-octahydrophenanthrene (PubChem CID 22045593) has the molecular formula C26H29F5 and a molecular weight of 436.51 g/mol. Its IUPAC name is 2-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethyl]-7-propyl-1,2,3,4,5,6,7,8-octahydrophenanthrene.
| Compound Name | 2-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethyl]-7-propyl-1,2,3,4,5,6,7,8-octahydrophenanthrene |
|---|---|
| PubChem CID | 22045593 |
| Molecular Formula | C26H29F5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 2-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethyl]-7-propyl-1,2,3,4,5,6,7,8-octahydrophenanthrene |
| SMILES | CCCC1CCc2c(ccc3c2CCC(CCc2cc(F)c(C(F)(F)F)c(F)c2)C3)C1 |
| InChI | InChI=1S/C26H29F5/c1-2-3-16-6-10-21-19(12-16)8-9-20-13-17(7-11-22(20)21)4-5-18-14-23(27)25(24(28)15-18)26(29,30)31/h8-9,14-17H,2-7,10-13H2,1H3 |
| InChIKey | GTMBQINTQDBOIQ-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |